Results
Spectrum Prediction Input Parameters:
| Parent Compound Structure (InChi Format) | InChI=1S/C21H20O12/c22-6-12(27)19-16(29)17(30)21(32-19)33-20-15(28)14-11(26)4-8(23)5-13(14)31-18(20)7-1-2-9(24)10(25)3-7/h1-5,12,16-17,19,21-27,29-30H,6H2 |
|---|---|
| Parent Compound Mass | 464.09547607612 |
| Spectra Type | ESI |
| Ion Mode | Positive |
| Adduct Type | [M+H]+ |
| Probability Threshold | 0.001 |
| Status | Completed |
Runtime Info:
0 [main] INFO net.sf.jnati.deploy.artefact.ConfigManager - Loading global configuration
12 [main] DEBUG net.sf.jnati.deploy.artefact.ConfigManager - Loading defaults: jar:file:/opt/msrb/msrb-fragmenter.jar!/META-INF/jnati/jnati.default-properties
14 [main] INFO net.sf.jnati.deploy.artefact.ConfigManager - Loading artefact configuration: jniinchi-1.03_1
17 [main] DEBUG net.sf.jnati.deploy.artefact.ConfigManager - Loading instance defaults: jar:file:/opt/msrb/msrb-fragmenter.jar!/META-INF/jnati/jnati.instance.default-properties
20 [main] INFO net.sf.jnati.deploy.repository.ClasspathRepository - Searching classpath for: jniinchi-1.03_1-LINUX-AMD64
23 [main] INFO net.sf.jnati.deploy.repository.LocalRepository - Searching local repository for: jniinchi-1.03_1-LINUX-AMD64
24 [main] DEBUG net.sf.jnati.deploy.repository.LocalRepository - Artefact path: /root/.jnati/repo/jniinchi/1.03_1/LINUX-AMD64
24 [main] INFO net.sf.jnati.deploy.repository.LocalRepository - Creating artefact: /root/.jnati/repo/jniinchi/1.03_1/LINUX-AMD64
26 [main] DEBUG net.sf.jnati.deploy.source.JarSource - Opening jar: /opt/msrb/msrb-fragmenter.jar
28 [main] INFO net.sf.jnati.deploy.artefact.ManifestReader - Reading manifest
165 [main] INFO net.sf.jnati.deploy.resolver.ArtefactResolver - Copying files to repository: /root/.jnati/repo/jniinchi/1.03_1/LINUX-AMD64
176 [main] INFO net.sf.jnati.deploy.NativeArtefactLocator - Artefact (jniinchi-1.03_1-LINUX-AMD64) location: /root/.jnati/repo/jniinchi/1.03_1/LINUX-AMD64
177 [main] DEBUG net.sf.jnati.deploy.NativeLibraryLoader - Loading library: /root/.jnati/repo/jniinchi/1.03_1/LINUX-AMD64/libJniInchi-1.03_1-LINUX-AMD64.so
STATUS REPORT = 1
Each specified adduct is covered for the class of FLAVONOL. Next Step: Predicting MS spectra for the following adduct types: [[M+H]+]
Saving spectrum to /root/output/output.txt_[M+H]+.log
Results:
Computed Results: Download
Predicted Low Energy MsMs Spectrum (10V), [M+H]+
Predicted Medium Energy MsMs Spectrum (20V), [M+H]+
Predicted High Energy MsMs Spectrum (40V), [M+H]+
Peak Table and Fragment Structures
Fragment IDs are shown in red. Corresponding scores for each fragment are in blue.| energy0 | |||
|---|---|---|---|
| 465.10275 | 100.0 | 0 | 1 |
| 465.10275207612 | 100.0 | ||
| energy1 | |||
| 465.10275 | 100.0 | 0 | 1 |
| 419.09727 | 3.0 | 1 | 1 |
| 391.10235 | 3.0 | 2 | 1 |
| 153.01823 | 3.0 | 3 | 1 |
| 465.10275207612 | 3.0 | ||
| energy2 | |||
| 465.10275 | 52.0 | 0 | 1 |
| 419.09727 | 20.0 | 1 | 1 |
| 153.01823 | 100.0 | 3 | 1 |
| 139.03897 | 26.0 | 4 5 | [1, 1] |
| 123.04405 | 6.0 | 6 | 1 |
| 68.9971 | 32.0 | 7 | 1 |
| 465.10275207612 | 32.0 | ||
| Structure | ID | Mass | SMILES |
|---|---|---|---|
![]() | 0 | 465.10275 | OC=1C=C(O)C2=C(OC(C=3C=CC(O)=C(O)C3)=C(OC4OC(C(O)CO)C(O)C4O)C2=[OH+])C1 |
![]() | 1 | 419.09727 | OC=1C=C(O)C=2C(=[OH+])C(OC3OC(C(O)CO)C(O)C3O)=C(OC2C1)C4=C=CC=C4 |
![]() | 2 | 391.10235 | OC1=CC=CC=2OC(C=3C=CC3)=C(OC4OC(C(O)CO)C(O)C4O)C(=[OH+])C12 |
![]() | 3 | 153.01823 | OC=1C=C(O)C=2C(=[OH+])OC2C1 |
![]() | 4 | 139.03897 | OC1=CC=C(C=[OH+])C(O)=C1 |
![]() | 5 | 139.03897 | OC1=CC=C(C=[OH+])C(O)=C1 |
![]() | 6 | 123.04405 | OC1=CC(=C)C=CC1=[OH+] |
![]() | 7 | 68.99710 | O=C1O[C+]=C1 |






